jaydenamos95 jaydenamos95

02-06-2022
Chemistry

contestada

Express this number in scientific notation.

31,000,000,000

Respuesta :

boolilina boolilina

02-06-2022

Answer:

3.1 x 10^10

Explanation:

there are 9 zeroes, so the quick way is too just add a one to the 9 and you get 10, so that is your power.

Answer Link

Otras preguntas

How do you think americans would feel if other countries began to urge the united states to increase environmental standards?

The structure of the cell membrane was discovered in 1895 by _________. finding a similarity to olive oil, he discovers membranes are made of __________.

5. Use excel?s irr function for this problem. Rancho cucamonga has a 6% cost of capital. The firm has an investment opportunity that costs $2,000. Riverside exp

The population of a rabbit colony triples every 3 days. The population starts at 10 rabbits. Write an exponential function that will model the population of the

The critical values for a 2-tailed sign test for 13-coin flips (alpha of. 05) is:_____.

Use the laplace transform to solve the given initial-value problem. y'' − 6y' 13y = 0, y(0) = 0, y'(0) = −5

How did World War II change the world by 1945? LEQ

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

The extent to which children are liked or disliked by their peer group is termed: ________ a) sociometric status. b) socioemotional standing. c) acceptance r

Fire __________ systems are devices installed and maintained to detect and respond to a fire, potential fire, or combustion danger situation.